C14H20N5O8P — CID 163898551
[(2R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid (PubChem CID 163898551) has the molecular formula C14H20N5O8P and a molecular weight of 417.32 g/mol. Its IUPAC name is [(2R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid.
| Compound Name | [(2R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid |
|---|---|
| PubChem CID | 163898551 |
| Molecular Formula | C14H20N5O8P |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | [(2R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid |
| SMILES | O=c1[nH]cnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)N2CCOCC2)C(O)C1O |
| InChI | InChI=1S/C14H20N5O8P/c20-10-8(5-26-28(23,24)18-1-3-25-4-2-18)27-14(11(10)21)19-7-17-9-12(19)15-6-16-13(9)22/h6-8,10-11,14,20-21H,1-5H2,(H,23,24)(H,15,16,22)/t8-,10?,11?,14-/m1/s1 |
| InChIKey | QHUOFSRQMORNLV-BUTJNPDOSA-N |
| XLogP | -1.81 |
| TPSA | 172.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|