C10H16N7O12P3 — CID 88989501
[[5-(6-aminopurin-9-yl)-4-diazenyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 88989501) has the molecular formula C10H16N7O12P3 and a molecular weight of 519.20 g/mol. Its IUPAC name is [[5-(6-aminopurin-9-yl)-4-diazenyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(6-aminopurin-9-yl)-4-diazenyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 88989501 |
| Molecular Formula | C10H16N7O12P3 |
| Molecular Weight | 519.20 g/mol |
| Exact Mass | 519.01 |
| IUPAC Name | [[5-(6-aminopurin-9-yl)-4-diazenyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [H]/N=N/C1C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C10H16N7O12P3/c11-8-6-9(14-2-13-8)17(3-15-6)10-5(16-12)7(18)4(27-10)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-5,7,10,12,18H,1H2,(H,22,23)(H,24,25)(H2,11,13,14)(H2,19,20,21)/b16-12+ |
| InChIKey | GAKDULTURNOGRT-FOWTUZBSSA-N |
| XLogP | -0.59 |
| TPSA | 295.11 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.20 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|