C14H19N5O6Se — CID 170942710
(2S)-2-amino-4-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methylselanyl]butanoic acid (PubChem CID 170942710) has the molecular formula C14H19N5O6Se and a molecular weight of 432.30 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methylselanyl]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methylselanyl]butanoic acid |
|---|---|
| PubChem CID | 170942710 |
| Molecular Formula | C14H19N5O6Se |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methylselanyl]butanoic acid |
| SMILES | N[C@@H](CC[Se]C[C@H]1O[C@@H](n2cnc3c(=O)[nH]cnc32)[C@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C14H19N5O6Se/c15-6(14(23)24)1-2-26-3-7-9(20)10(21)13(25-7)19-5-18-8-11(19)16-4-17-12(8)22/h4-7,9-10,13,20-21H,1-3,15H2,(H,23,24)(H,16,17,22)/t6-,7+,9+,10+,13+/m0/s1 |
| InChIKey | HCLAVCKNXAGSKP-WFMPWKQPSA-N |
| XLogP | -1.92 |
| TPSA | 176.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|