C14H15F2N7O6 — CID 174589258
(2R,3S,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;1-fluoropyrimidine-2,4-dione (PubChem CID 174589258) has the molecular formula C14H15F2N7O6 and a molecular weight of 415.31 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;1-fluoropyrimidine-2,4-dione.
| Compound Name | (2R,3S,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;1-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174589258 |
| Molecular Formula | C14H15F2N7O6 |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (2R,3S,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;1-fluoropyrimidine-2,4-dione |
| SMILES | Nc1nc(F)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O.O=c1ccn(F)c(=O)[nH]1 |
| InChI | InChI=1S/C10H12FN5O4.C4H3FN2O2/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9;5-7-2-1-3(8)6-4(7)9/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15);1-2H,(H,6,8,9)/t3-,5-,6+,9-;/m1./s1 |
| InChIKey | BTMVZVKHEGTDCM-ITHLILATSA-N |
| XLogP | -2.57 |
| TPSA | 194.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |