C31H29N7O6 — CID 10952106
N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[[(1R)-1-(4-nitrophenyl)ethyl]amino]purin-9-yl]oxolan-3-yl]-4-phenylbenzamide (PubChem CID 10952106) has the molecular formula C31H29N7O6 and a molecular weight of 595.62 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[[(1R)-1-(4-nitrophenyl)ethyl]amino]purin-9-yl]oxolan-3-yl]-4-phenylbenzamide.
| Compound Name | N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[[(1R)-1-(4-nitrophenyl)ethyl]amino]purin-9-yl]oxolan-3-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 10952106 |
| Molecular Formula | C31H29N7O6 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[[(1R)-1-(4-nitrophenyl)ethyl]amino]purin-9-yl]oxolan-3-yl]-4-phenylbenzamide |
| SMILES | C[C@@H](Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1NC(=O)c1ccc(-c2ccccc2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H29N7O6/c1-18(19-11-13-23(14-12-19)38(42)43)35-28-26-29(33-16-32-28)37(17-34-26)31-25(27(40)24(15-39)44-31)36-30(41)22-9-7-21(8-10-22)20-5-3-2-4-6-20/h2-14,16-18,24-25,27,31,39-40H,15H2,1H3,(H,36,41)(H,32,33,35)/t18-,24-,25-,27-,31-/m1/s1 |
| InChIKey | DKIBOLBFLDFFNC-IHPJMDQESA-N |
| XLogP | 3.62 |
| TPSA | 177.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|