C31H30N8O6 — CID 10393959
4-(cyclopropylamino)-N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolan-3-yl]-3-nitrobenzamide (PubChem CID 10393959) has the molecular formula C31H30N8O6 and a molecular weight of 610.63 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolan-3-yl]-3-nitrobenzamide.
| Compound Name | 4-(cyclopropylamino)-N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolan-3-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 10393959 |
| Molecular Formula | C31H30N8O6 |
| Molecular Weight | 610.63 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | 4-(cyclopropylamino)-N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolan-3-yl]-3-nitrobenzamide |
| SMILES | O=C(N[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(NCc3cccc4ccccc34)ncnc21)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H30N8O6/c40-14-24-27(41)25(37-30(42)18-8-11-22(36-20-9-10-20)23(12-18)39(43)44)31(45-24)38-16-35-26-28(33-15-34-29(26)38)32-13-19-6-3-5-17-4-1-2-7-21(17)19/h1-8,11-12,15-16,20,24-25,27,31,36,40-41H,9-10,13-14H2,(H,37,42)(H,32,33,34)/t24-,25-,27-,31-/m1/s1 |
| InChIKey | LYYQJHXCIHPYNI-VLVHCFGSSA-N |
| XLogP | 3.12 |
| TPSA | 189.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|