C33H34N8O6 — CID 11734889
4-(cyclopentylamino)-N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl]-3-nitrobenzamide (PubChem CID 11734889) has the molecular formula C33H34N8O6 and a molecular weight of 638.69 g/mol. Its IUPAC name is 4-(cyclopentylamino)-N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl]-3-nitrobenzamide.
| Compound Name | 4-(cyclopentylamino)-N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 11734889 |
| Molecular Formula | C33H34N8O6 |
| Molecular Weight | 638.69 g/mol |
| Exact Mass | 638.26 |
| IUPAC Name | 4-(cyclopentylamino)-N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl]-3-nitrobenzamide |
| SMILES | O=C(NC[C@H]1O[C@@H](n2cnc3c(NCc4cccc5ccccc45)ncnc32)[C@H](O)[C@@H]1O)c1ccc(NC2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H34N8O6/c42-28-26(16-35-32(44)20-12-13-24(25(14-20)41(45)46)39-22-9-2-3-10-22)47-33(29(28)43)40-18-38-27-30(36-17-37-31(27)40)34-15-21-8-5-7-19-6-1-4-11-23(19)21/h1,4-8,11-14,17-18,22,26,28-29,33,39,42-43H,2-3,9-10,15-16H2,(H,35,44)(H,34,36,37)/t26-,28-,29-,33-/m1/s1 |
| InChIKey | CNBCWKBOSIMZQY-QBVBFOPXSA-N |
| XLogP | 3.90 |
| TPSA | 189.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.69 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|