C13H17Cl2N4O8P — CID 144952503
2-[[(2S)-5-(2,6-dichloropurin-9-yl)oxolan-2-yl]methoxy]-2-phosphonoacetic acid;methanol (PubChem CID 144952503) has the molecular formula C13H17Cl2N4O8P and a molecular weight of 459.18 g/mol. Its IUPAC name is 2-[[(2S)-5-(2,6-dichloropurin-9-yl)oxolan-2-yl]methoxy]-2-phosphonoacetic acid;methanol.
| Compound Name | 2-[[(2S)-5-(2,6-dichloropurin-9-yl)oxolan-2-yl]methoxy]-2-phosphonoacetic acid;methanol |
|---|---|
| PubChem CID | 144952503 |
| Molecular Formula | C13H17Cl2N4O8P |
| Molecular Weight | 459.18 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 2-[[(2S)-5-(2,6-dichloropurin-9-yl)oxolan-2-yl]methoxy]-2-phosphonoacetic acid;methanol |
| SMILES | CO.O=C(O)C(OC[C@@H]1CCC(n2cnc3c(Cl)nc(Cl)nc32)O1)P(=O)(O)O |
| InChI | InChI=1S/C12H13Cl2N4O7P.CH4O/c13-8-7-9(17-12(14)16-8)18(4-15-7)6-2-1-5(25-6)3-24-11(10(19)20)26(21,22)23;1-2/h4-6,11H,1-3H2,(H,19,20)(H2,21,22,23);2H,1H3/t5-,6?,11?;/m0./s1 |
| InChIKey | PDYWBDXUUJVLOM-LIDVTQMKSA-N |
| XLogP | 1.02 |
| TPSA | 177.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|