C15H22N5O6P — CID 156543905
2-dihydroxyphosphanyl-2-[[(2S,5R)-5-[6-(propan-2-ylamino)purin-9-yl]oxolan-2-yl]methoxy]acetic acid (PubChem CID 156543905) has the molecular formula C15H22N5O6P and a molecular weight of 399.34 g/mol. Its IUPAC name is 2-dihydroxyphosphanyl-2-[[(2S,5R)-5-[6-(propan-2-ylamino)purin-9-yl]oxolan-2-yl]methoxy]acetic acid.
| Compound Name | 2-dihydroxyphosphanyl-2-[[(2S,5R)-5-[6-(propan-2-ylamino)purin-9-yl]oxolan-2-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 156543905 |
| Molecular Formula | C15H22N5O6P |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-dihydroxyphosphanyl-2-[[(2S,5R)-5-[6-(propan-2-ylamino)purin-9-yl]oxolan-2-yl]methoxy]acetic acid |
| SMILES | CC(C)Nc1ncnc2c1ncn2[C@H]1CC[C@@H](COC(C(=O)O)P(O)O)O1 |
| InChI | InChI=1S/C15H22N5O6P/c1-8(2)19-12-11-13(17-6-16-12)20(7-18-11)10-4-3-9(26-10)5-25-15(14(21)22)27(23)24/h6-10,15,23-24H,3-5H2,1-2H3,(H,21,22)(H,16,17,19)/t9-,10+,15?/m0/s1 |
| InChIKey | UZRNHCVZOTWOLO-TZPSPIKVSA-N |
| XLogP | 1.05 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|