C21H22ClN5O5 — CID 167153298
[(4R)-4-acetyloxy-5-[6-(benzylamino)-2-chloropurin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 167153298) has the molecular formula C21H22ClN5O5 and a molecular weight of 459.89 g/mol. Its IUPAC name is [(4R)-4-acetyloxy-5-[6-(benzylamino)-2-chloropurin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(4R)-4-acetyloxy-5-[6-(benzylamino)-2-chloropurin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 167153298 |
| Molecular Formula | C21H22ClN5O5 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [(4R)-4-acetyloxy-5-[6-(benzylamino)-2-chloropurin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1C[C@@H](OC(C)=O)C(n2cnc3c(NCc4ccccc4)nc(Cl)nc32)O1 |
| InChI | InChI=1S/C21H22ClN5O5/c1-12(28)30-10-15-8-16(31-13(2)29)20(32-15)27-11-24-17-18(25-21(22)26-19(17)27)23-9-14-6-4-3-5-7-14/h3-7,11,15-16,20H,8-10H2,1-2H3,(H,23,25,26)/t15?,16-,20?/m1/s1 |
| InChIKey | XLOREQCGCKEILZ-LFDOHDQPSA-N |
| XLogP | 2.87 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |