C13H16ClN7 — CID 118073626
2-chloro-N-(1,3-dimethylpyrazol-4-yl)-9-propan-2-ylpurin-6-amine (PubChem CID 118073626) has the molecular formula C13H16ClN7 and a molecular weight of 305.77 g/mol. Its IUPAC name is 2-chloro-N-(1,3-dimethylpyrazol-4-yl)-9-propan-2-ylpurin-6-amine.
| Compound Name | 2-chloro-N-(1,3-dimethylpyrazol-4-yl)-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 118073626 |
| Molecular Formula | C13H16ClN7 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-chloro-N-(1,3-dimethylpyrazol-4-yl)-9-propan-2-ylpurin-6-amine |
| SMILES | Cc1nn(C)cc1Nc1nc(Cl)nc2c1ncn2C(C)C |
| InChI | InChI=1S/C13H16ClN7/c1-7(2)21-6-15-10-11(17-13(14)18-12(10)21)16-9-5-20(4)19-8(9)3/h5-7H,1-4H3,(H,16,17,18) |
| InChIKey | LWFFCSZKKYVOKE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |