C12H14ClN7 — CID 118073689
2-chloro-N-(1-methylpyrazol-4-yl)-9-propan-2-ylpurin-6-amine (PubChem CID 118073689) has the molecular formula C12H14ClN7 and a molecular weight of 291.75 g/mol. Its IUPAC name is 2-chloro-N-(1-methylpyrazol-4-yl)-9-propan-2-ylpurin-6-amine.
| Compound Name | 2-chloro-N-(1-methylpyrazol-4-yl)-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 118073689 |
| Molecular Formula | C12H14ClN7 |
| Molecular Weight | 291.75 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-chloro-N-(1-methylpyrazol-4-yl)-9-propan-2-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2c(Nc3cnn(C)c3)nc(Cl)nc21 |
| InChI | InChI=1S/C12H14ClN7/c1-7(2)20-6-14-9-10(17-12(13)18-11(9)20)16-8-4-15-19(3)5-8/h4-7H,1-3H3,(H,16,17,18) |
| InChIKey | JRRFXJYMRWXSGE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |