C30H36N8O2 — CID 24762175
[4-[[2-(3-morpholin-4-ylpropylamino)-9-phenylpurin-6-yl]amino]phenyl]-piperidin-1-ylmethanone (PubChem CID 24762175) has the molecular formula C30H36N8O2 and a molecular weight of 540.67 g/mol. Its IUPAC name is [4-[[2-(3-morpholin-4-ylpropylamino)-9-phenylpurin-6-yl]amino]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-[[2-(3-morpholin-4-ylpropylamino)-9-phenylpurin-6-yl]amino]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 24762175 |
| Molecular Formula | C30H36N8O2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | [4-[[2-(3-morpholin-4-ylpropylamino)-9-phenylpurin-6-yl]amino]phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(Nc2nc(NCCCN3CCOCC3)nc3c2ncn3-c2ccccc2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C30H36N8O2/c39-29(37-16-5-2-6-17-37)23-10-12-24(13-11-23)33-27-26-28(38(22-32-26)25-8-3-1-4-9-25)35-30(34-27)31-14-7-15-36-18-20-40-21-19-36/h1,3-4,8-13,22H,2,5-7,14-21H2,(H2,31,33,34,35) |
| InChIKey | AXJCTFGRKZYHLB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|