C10H9ClF3N3 — CID 153146421
3-chloro-1,1,1-trifluoro-4-methylimino-4-pyridin-2-ylbut-2-en-2-amine (PubChem CID 153146421) has the molecular formula C10H9ClF3N3 and a molecular weight of 263.65 g/mol. Its IUPAC name is 3-chloro-1,1,1-trifluoro-4-methylimino-4-pyridin-2-ylbut-2-en-2-amine.
| Compound Name | 3-chloro-1,1,1-trifluoro-4-methylimino-4-pyridin-2-ylbut-2-en-2-amine |
|---|---|
| PubChem CID | 153146421 |
| Molecular Formula | C10H9ClF3N3 |
| Molecular Weight | 263.65 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 3-chloro-1,1,1-trifluoro-4-methylimino-4-pyridin-2-ylbut-2-en-2-amine |
| SMILES | C/N=C(/C(Cl)=C(N)C(F)(F)F)c1ccccn1 |
| InChI | InChI=1S/C10H9ClF3N3/c1-16-8(6-4-2-3-5-17-6)7(11)9(15)10(12,13)14/h2-5H,15H2,1H3/b9-7?,16-8+ |
| InChIKey | WSVVPFGBFLRJMP-XJNHQHODSA-N |
| XLogP | 2.47 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.65 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|