C14H23N3 — CID 156721762
ethane;1-N,2-N,3-trimethyl-1-pyridin-2-ylbutane-1,2-diimine (PubChem CID 156721762) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is ethane;1-N,2-N,3-trimethyl-1-pyridin-2-ylbutane-1,2-diimine.
| Compound Name | ethane;1-N,2-N,3-trimethyl-1-pyridin-2-ylbutane-1,2-diimine |
|---|---|
| PubChem CID | 156721762 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | ethane;1-N,2-N,3-trimethyl-1-pyridin-2-ylbutane-1,2-diimine |
| SMILES | C/N=C(C(=N\C)\C(C)C)/c1ccccn1.CC |
| InChI | InChI=1S/C12H17N3.C2H6/c1-9(2)11(13-3)12(14-4)10-7-5-6-8-15-10;1-2/h5-9H,1-4H3;1-2H3/b13-11+,14-12-; |
| InChIKey | JPZWCRQOPGDAMQ-NBWZLDDWSA-N |
| XLogP | 3.25 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|