About anthracene-1-carboxamide;pyridine-2-carboxamide
anthracene-1-carboxamide;pyridine-2-carboxamide (PubChem CID 87214967) has the molecular formula C21H17N3O2
and a molecular weight of 343.39 g/mol. Its IUPAC name is anthracene-1-carboxamide;pyridine-2-carboxamide.
Molecular Properties
| Compound Name | anthracene-1-carboxamide;pyridine-2-carboxamide |
| PubChem CID | 87214967 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | anthracene-1-carboxamide;pyridine-2-carboxamide |
| SMILES | NC(=O)c1cccc2cc3ccccc3cc12.NC(=O)c1ccccn1 |
| InChI | InChI=1S/C15H11NO.C6H6N2O/c16-15(17)13-7-3-6-12-8-10-4-1-2-5-11(10)9-14(12)13;7-6(9)5-3-1-2-4-8-5/h1-9H,(H2,16,17);1-4H,(H2,7,9) |
| InChIKey | OTMZVALHCLIAPE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene-1-carboxamide;pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-1-carboxamide;pyridine-2-carboxamide?
The IUPAC name of anthracene-1-carboxamide;pyridine-2-carboxamide (CID 87214967) is anthracene-1-carboxamide;pyridine-2-carboxamide.
What is the SMILES notation for anthracene-1-carboxamide;pyridine-2-carboxamide?
The canonical SMILES for anthracene-1-carboxamide;pyridine-2-carboxamide is NC(=O)c1cccc2cc3ccccc3cc12.NC(=O)c1ccccn1.
What is the InChIKey of anthracene-1-carboxamide;pyridine-2-carboxamide?
The InChIKey is OTMZVALHCLIAPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO.C6H6N2O/c16-15(17)13-7-3-6-12-8-10-4-1-2-5-11(10)9-14(12)13;7-6(9)5-3-1-2-4-8-5/h1-9H,(H2,16,17);1-4H,(H2,7,9).
What are the key properties of anthracene-1-carboxamide;pyridine-2-carboxamide?
anthracene-1-carboxamide;pyridine-2-carboxamide has a molecular weight of 343.39 g/mol, XLogP of 3.27, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-1-carboxamide;pyridine-2-carboxamide is sourced from PubChem (CID 87214967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).