C13H13N7O — CID 175768938
1-(1,2,5-triazonin-2-yl)-1,2,5-triazonine-6-carboxamide (PubChem CID 175768938) has the molecular formula C13H13N7O and a molecular weight of 283.30 g/mol. Its IUPAC name is 1-(1,2,5-triazonin-2-yl)-1,2,5-triazonine-6-carboxamide.
| Compound Name | 1-(1,2,5-triazonin-2-yl)-1,2,5-triazonine-6-carboxamide |
|---|---|
| PubChem CID | 175768938 |
| Molecular Formula | C13H13N7O |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-(1,2,5-triazonin-2-yl)-1,2,5-triazonine-6-carboxamide |
| SMILES | NC(=O)c1cccn(-n2ccnccccn2)nccn1 |
| InChI | InChI=1S/C13H13N7O/c14-13(21)12-4-3-10-19(18-8-7-16-12)20-11-9-15-5-1-2-6-17-20/h1-11H,(H2,14,21)/b2-1-,10-3-,11-9-,12-4-,15-5-,16-7-,17-6-,18-8- |
| InChIKey | BHRUGYZTYAIQJK-XXBNNLKZSA-N |
| XLogP | 0.53 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |