About pyridazine-3-carboxamide;pyridine
pyridazine-3-carboxamide;pyridine (PubChem CID 172726513) has the molecular formula C10H10N4O
and a molecular weight of 202.22 g/mol. Its IUPAC name is pyridazine-3-carboxamide;pyridine.
Molecular Properties
| Compound Name | pyridazine-3-carboxamide;pyridine |
| PubChem CID | 172726513 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | pyridazine-3-carboxamide;pyridine |
| SMILES | NC(=O)c1cccnn1.c1ccncc1 |
| InChI | InChI=1S/C5H5N3O.C5H5N/c6-5(9)4-2-1-3-7-8-4;1-2-4-6-5-3-1/h1-3H,(H2,6,9);1-5H |
| InChIKey | HFIVCCJLAGRCPX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridazine-3-carboxamide;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridazine-3-carboxamide;pyridine?
The IUPAC name of pyridazine-3-carboxamide;pyridine (CID 172726513) is pyridazine-3-carboxamide;pyridine.
What is the SMILES notation for pyridazine-3-carboxamide;pyridine?
The canonical SMILES for pyridazine-3-carboxamide;pyridine is NC(=O)c1cccnn1.c1ccncc1.
What is the InChIKey of pyridazine-3-carboxamide;pyridine?
The InChIKey is HFIVCCJLAGRCPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O.C5H5N/c6-5(9)4-2-1-3-7-8-4;1-2-4-6-5-3-1/h1-3H,(H2,6,9);1-5H.
What are the key properties of pyridazine-3-carboxamide;pyridine?
pyridazine-3-carboxamide;pyridine has a molecular weight of 202.22 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridazine-3-carboxamide;pyridine is sourced from PubChem (CID 172726513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).