About acetic acid;pyridazine-3-carboxylic acid
acetic acid;pyridazine-3-carboxylic acid (PubChem CID 162329499) has the molecular formula C7H8N2O4
and a molecular weight of 184.15 g/mol. Its IUPAC name is acetic acid;pyridazine-3-carboxylic acid.
Molecular Properties
| Compound Name | acetic acid;pyridazine-3-carboxylic acid |
| PubChem CID | 162329499 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | acetic acid;pyridazine-3-carboxylic acid |
| SMILES | CC(=O)O.O=C(O)c1cccnn1 |
| InChI | InChI=1S/C5H4N2O2.C2H4O2/c8-5(9)4-2-1-3-6-7-4;1-2(3)4/h1-3H,(H,8,9);1H3,(H,3,4) |
| InChIKey | RUYXWVRKMNFQCA-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;pyridazine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;pyridazine-3-carboxylic acid?
The IUPAC name of acetic acid;pyridazine-3-carboxylic acid (CID 162329499) is acetic acid;pyridazine-3-carboxylic acid.
What is the SMILES notation for acetic acid;pyridazine-3-carboxylic acid?
The canonical SMILES for acetic acid;pyridazine-3-carboxylic acid is CC(=O)O.O=C(O)c1cccnn1.
What is the InChIKey of acetic acid;pyridazine-3-carboxylic acid?
The InChIKey is RUYXWVRKMNFQCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2.C2H4O2/c8-5(9)4-2-1-3-6-7-4;1-2(3)4/h1-3H,(H,8,9);1H3,(H,3,4).
What are the key properties of acetic acid;pyridazine-3-carboxylic acid?
acetic acid;pyridazine-3-carboxylic acid has a molecular weight of 184.15 g/mol, XLogP of 0.27, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;pyridazine-3-carboxylic acid is sourced from PubChem (CID 162329499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).