C10H7FN2O2S — CID 83295852
2-[2-(5-fluoro-3-pyridinyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 83295852) has the molecular formula C10H7FN2O2S and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-[2-(5-fluoro-3-pyridinyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(5-fluoro-3-pyridinyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 83295852 |
| Molecular Formula | C10H7FN2O2S |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 2-[2-(5-fluoro-3-pyridinyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(-c2cncc(F)c2)n1 |
| InChI | InChI=1S/C10H7FN2O2S/c11-7-1-6(3-12-4-7)10-13-8(5-16-10)2-9(14)15/h1,3-5H,2H2,(H,14,15) |
| InChIKey | PXISUDLXEUMOQM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |