C26H31FN4OS — CID 154859701
2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]-N-[4-(4-phenylpiperazin-1-yl)butyl]acetamide (PubChem CID 154859701) has the molecular formula C26H31FN4OS and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]-N-[4-(4-phenylpiperazin-1-yl)butyl]acetamide.
| Compound Name | 2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]-N-[4-(4-phenylpiperazin-1-yl)butyl]acetamide |
|---|---|
| PubChem CID | 154859701 |
| Molecular Formula | C26H31FN4OS |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]-N-[4-(4-phenylpiperazin-1-yl)butyl]acetamide |
| SMILES | O=C(Cc1csc(Cc2ccc(F)cc2)n1)NCCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H31FN4OS/c27-22-10-8-21(9-11-22)18-26-29-23(20-33-26)19-25(32)28-12-4-5-13-30-14-16-31(17-15-30)24-6-2-1-3-7-24/h1-3,6-11,20H,4-5,12-19H2,(H,28,32) |
| InChIKey | DPKOUWDOQVOFLR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|