C26H30ClN3O4 — CID 24717437
(2R)-1-(3-chlorobenzoyl)-N-[4-[(4-methoxybenzoyl)amino]cyclohexyl]pyrrolidine-2-carboxamide (PubChem CID 24717437) has the molecular formula C26H30ClN3O4 and a molecular weight of 484.00 g/mol. Its IUPAC name is (2R)-1-(3-chlorobenzoyl)-N-[4-[(4-methoxybenzoyl)amino]cyclohexyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(3-chlorobenzoyl)-N-[4-[(4-methoxybenzoyl)amino]cyclohexyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24717437 |
| Molecular Formula | C26H30ClN3O4 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | (2R)-1-(3-chlorobenzoyl)-N-[4-[(4-methoxybenzoyl)amino]cyclohexyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(C(=O)NC2CCC(NC(=O)[C@H]3CCCN3C(=O)c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C26H30ClN3O4/c1-34-22-13-7-17(8-14-22)24(31)28-20-9-11-21(12-10-20)29-25(32)23-6-3-15-30(23)26(33)18-4-2-5-19(27)16-18/h2,4-5,7-8,13-14,16,20-21,23H,3,6,9-12,15H2,1H3,(H,28,31)(H,29,32)/t20?,21?,23-/m1/s1 |
| InChIKey | DBLBFPDUSZWRTQ-YDPRHXJPSA-N |
| XLogP | 3.81 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |