C21H27ClN2O3 — CID 110625694
1-[4-(3-chlorophenyl)-4-oxobutanoyl]-N-cyclohexylpyrrolidine-2-carboxamide (PubChem CID 110625694) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)-4-oxobutanoyl]-N-cyclohexylpyrrolidine-2-carboxamide.
| Compound Name | 1-[4-(3-chlorophenyl)-4-oxobutanoyl]-N-cyclohexylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110625694 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[4-(3-chlorophenyl)-4-oxobutanoyl]-N-cyclohexylpyrrolidine-2-carboxamide |
| SMILES | O=C(CCC(=O)N1CCCC1C(=O)NC1CCCCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H27ClN2O3/c22-16-7-4-6-15(14-16)19(25)11-12-20(26)24-13-5-10-18(24)21(27)23-17-8-2-1-3-9-17/h4,6-7,14,17-18H,1-3,5,8-13H2,(H,23,27) |
| InChIKey | AXJZDRYVISTCSL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |