C12H14ClN3S — CID 62480981
2-chloro-6-methyl-N-(1-thiophen-2-ylpropyl)pyrimidin-4-amine (PubChem CID 62480981) has the molecular formula C12H14ClN3S and a molecular weight of 267.79 g/mol. Its IUPAC name is 2-chloro-6-methyl-N-(1-thiophen-2-ylpropyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-6-methyl-N-(1-thiophen-2-ylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 62480981 |
| Molecular Formula | C12H14ClN3S |
| Molecular Weight | 267.79 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-chloro-6-methyl-N-(1-thiophen-2-ylpropyl)pyrimidin-4-amine |
| SMILES | CCC(Nc1cc(C)nc(Cl)n1)c1cccs1 |
| InChI | InChI=1S/C12H14ClN3S/c1-3-9(10-5-4-6-17-10)15-11-7-8(2)14-12(13)16-11/h4-7,9H,3H2,1-2H3,(H,14,15,16) |
| InChIKey | FNMJERUNQDFHAY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.79 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |