C16H22N2S — CID 107874590
5-tert-butyl-N-(1-thiophen-2-ylpropyl)pyridin-2-amine (PubChem CID 107874590) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 5-tert-butyl-N-(1-thiophen-2-ylpropyl)pyridin-2-amine.
| Compound Name | 5-tert-butyl-N-(1-thiophen-2-ylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107874590 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 5-tert-butyl-N-(1-thiophen-2-ylpropyl)pyridin-2-amine |
| SMILES | CCC(Nc1ccc(C(C)(C)C)cn1)c1cccs1 |
| InChI | InChI=1S/C16H22N2S/c1-5-13(14-7-6-10-19-14)18-15-9-8-12(11-17-15)16(2,3)4/h6-11,13H,5H2,1-4H3,(H,17,18) |
| InChIKey | URHMXYPQUOIWOH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |