C18H20N4S — CID 133336468
6-ethyl-2-pyridin-2-yl-N-(1-thiophen-2-ylpropyl)pyrimidin-4-amine (PubChem CID 133336468) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is 6-ethyl-2-pyridin-2-yl-N-(1-thiophen-2-ylpropyl)pyrimidin-4-amine.
| Compound Name | 6-ethyl-2-pyridin-2-yl-N-(1-thiophen-2-ylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133336468 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 6-ethyl-2-pyridin-2-yl-N-(1-thiophen-2-ylpropyl)pyrimidin-4-amine |
| SMILES | CCc1cc(NC(CC)c2cccs2)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C18H20N4S/c1-3-13-12-17(21-14(4-2)16-9-7-11-23-16)22-18(20-13)15-8-5-6-10-19-15/h5-12,14H,3-4H2,1-2H3,(H,20,21,22) |
| InChIKey | HBAXEXOZUVFURK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |