C16H14ClN7O — CID 123377877
3-[1-[(2-amino-7H-purin-6-yl)amino]ethyl]-8-chloro-2H-isoquinolin-1-one (PubChem CID 123377877) has the molecular formula C16H14ClN7O and a molecular weight of 355.79 g/mol. Its IUPAC name is 3-[1-[(2-amino-7H-purin-6-yl)amino]ethyl]-8-chloro-2H-isoquinolin-1-one.
| Compound Name | 3-[1-[(2-amino-7H-purin-6-yl)amino]ethyl]-8-chloro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 123377877 |
| Molecular Formula | C16H14ClN7O |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 3-[1-[(2-amino-7H-purin-6-yl)amino]ethyl]-8-chloro-2H-isoquinolin-1-one |
| SMILES | CC(Nc1nc(N)nc2nc[nH]c12)c1cc2cccc(Cl)c2c(=O)[nH]1 |
| InChI | InChI=1S/C16H14ClN7O/c1-7(21-14-12-13(20-6-19-12)23-16(18)24-14)10-5-8-3-2-4-9(17)11(8)15(25)22-10/h2-7H,1H3,(H,22,25)(H4,18,19,20,21,23,24) |
| InChIKey | XZMPWPRSYIHCRY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |