C23H21N7O — CID 118630884
2-[(1S)-1-[(2-amino-7H-purin-6-yl)amino]ethyl]-6-methyl-3-phenylquinolizin-4-one (PubChem CID 118630884) has the molecular formula C23H21N7O and a molecular weight of 411.47 g/mol. Its IUPAC name is 2-[(1S)-1-[(2-amino-7H-purin-6-yl)amino]ethyl]-6-methyl-3-phenylquinolizin-4-one.
| Compound Name | 2-[(1S)-1-[(2-amino-7H-purin-6-yl)amino]ethyl]-6-methyl-3-phenylquinolizin-4-one |
|---|---|
| PubChem CID | 118630884 |
| Molecular Formula | C23H21N7O |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-[(1S)-1-[(2-amino-7H-purin-6-yl)amino]ethyl]-6-methyl-3-phenylquinolizin-4-one |
| SMILES | Cc1cccc2cc([C@H](C)Nc3nc(N)nc4nc[nH]c34)c(-c3ccccc3)c(=O)n12 |
| InChI | InChI=1S/C23H21N7O/c1-13-7-6-10-16-11-17(18(22(31)30(13)16)15-8-4-3-5-9-15)14(2)27-21-19-20(26-12-25-19)28-23(24)29-21/h3-12,14H,1-2H3,(H4,24,25,26,27,28,29)/t14-/m0/s1 |
| InChIKey | VWEBUHOEVWNCKU-AWEZNQCLSA-N |
| XLogP | 3.70 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |