C11H13N7S — CID 114785367
6-N-[1-(1,3-thiazol-2-yl)propyl]-7H-purine-2,6-diamine (PubChem CID 114785367) has the molecular formula C11H13N7S and a molecular weight of 275.34 g/mol. Its IUPAC name is 6-N-[1-(1,3-thiazol-2-yl)propyl]-7H-purine-2,6-diamine.
| Compound Name | 6-N-[1-(1,3-thiazol-2-yl)propyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114785367 |
| Molecular Formula | C11H13N7S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 6-N-[1-(1,3-thiazol-2-yl)propyl]-7H-purine-2,6-diamine |
| SMILES | CCC(Nc1nc(N)nc2nc[nH]c12)c1nccs1 |
| InChI | InChI=1S/C11H13N7S/c1-2-6(10-13-3-4-19-10)16-9-7-8(15-5-14-7)17-11(12)18-9/h3-6H,2H2,1H3,(H4,12,14,15,16,17,18) |
| InChIKey | ZJUCFAVDHFCKPT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |