C14H16Cl2N4O — CID 87330339
(1R,2R,3S,4S)-3-[(2,5-dichloropyrimidin-4-yl)amino]-N,N-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 87330339) has the molecular formula C14H16Cl2N4O and a molecular weight of 327.22 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-[(2,5-dichloropyrimidin-4-yl)amino]-N,N-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,3S,4S)-3-[(2,5-dichloropyrimidin-4-yl)amino]-N,N-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 87330339 |
| Molecular Formula | C14H16Cl2N4O |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (1R,2R,3S,4S)-3-[(2,5-dichloropyrimidin-4-yl)amino]-N,N-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1[C@@H](Nc2nc(Cl)ncc2Cl)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H16Cl2N4O/c1-20(2)13(21)10-7-3-4-8(5-7)11(10)18-12-9(15)6-17-14(16)19-12/h3-4,6-8,10-11H,5H2,1-2H3,(H,17,18,19)/t7-,8+,10+,11-/m0/s1 |
| InChIKey | IPCICTHCHKDQDZ-URPMGSGRSA-N |
| XLogP | 2.47 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|