C8H5BrF2N2 — CID 43168321
2-(2-bromo-4,6-difluoroanilino)acetonitrile (PubChem CID 43168321) has the molecular formula C8H5BrF2N2 and a molecular weight of 247.04 g/mol. Its IUPAC name is 2-(2-bromo-4,6-difluoroanilino)acetonitrile.
| Compound Name | 2-(2-bromo-4,6-difluoroanilino)acetonitrile |
|---|---|
| PubChem CID | 43168321 |
| Molecular Formula | C8H5BrF2N2 |
| Molecular Weight | 247.04 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | 2-(2-bromo-4,6-difluoroanilino)acetonitrile |
| SMILES | N#CCNc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C8H5BrF2N2/c9-6-3-5(10)4-7(11)8(6)13-2-1-12/h3-4,13H,2H2 |
| InChIKey | PHYLCLNZMIOFJP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.04 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|