C13H8BrF4NO — CID 79891767
4-[(2-bromo-4,6-difluoroanilino)methyl]-2,6-difluorophenol (PubChem CID 79891767) has the molecular formula C13H8BrF4NO and a molecular weight of 350.11 g/mol. Its IUPAC name is 4-[(2-bromo-4,6-difluoroanilino)methyl]-2,6-difluorophenol.
| Compound Name | 4-[(2-bromo-4,6-difluoroanilino)methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 79891767 |
| Molecular Formula | C13H8BrF4NO |
| Molecular Weight | 350.11 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 4-[(2-bromo-4,6-difluoroanilino)methyl]-2,6-difluorophenol |
| SMILES | Oc1c(F)cc(CNc2c(F)cc(F)cc2Br)cc1F |
| InChI | InChI=1S/C13H8BrF4NO/c14-8-3-7(15)4-9(16)12(8)19-5-6-1-10(17)13(20)11(18)2-6/h1-4,19-20H,5H2 |
| InChIKey | HRYFYRGMQOSKSE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.11 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |