C14H19ClN2O2 — CID 81093718
2-chloro-4-(3,3-diethoxypropylamino)benzonitrile (PubChem CID 81093718) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 2-chloro-4-(3,3-diethoxypropylamino)benzonitrile.
| Compound Name | 2-chloro-4-(3,3-diethoxypropylamino)benzonitrile |
|---|---|
| PubChem CID | 81093718 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-chloro-4-(3,3-diethoxypropylamino)benzonitrile |
| SMILES | CCOC(CCNc1ccc(C#N)c(Cl)c1)OCC |
| InChI | InChI=1S/C14H19ClN2O2/c1-3-18-14(19-4-2)7-8-17-12-6-5-11(10-16)13(15)9-12/h5-6,9,14,17H,3-4,7-8H2,1-2H3 |
| InChIKey | BTABHARZEUIDRT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|