C14H19ClN2 — CID 114200100
2-chloro-4-(2,4-dimethylpentylamino)benzonitrile (PubChem CID 114200100) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is 2-chloro-4-(2,4-dimethylpentylamino)benzonitrile.
| Compound Name | 2-chloro-4-(2,4-dimethylpentylamino)benzonitrile |
|---|---|
| PubChem CID | 114200100 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-chloro-4-(2,4-dimethylpentylamino)benzonitrile |
| SMILES | CC(C)CC(C)CNc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2/c1-10(2)6-11(3)9-17-13-5-4-12(8-16)14(15)7-13/h4-5,7,10-11,17H,6,9H2,1-3H3 |
| InChIKey | AZXAKNIPOAEUAB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |