C19H21ClN2O — CID 133400367
2-chloro-4-[(4-hydroxy-3,3-dimethyl-2-phenylbutyl)amino]benzonitrile (PubChem CID 133400367) has the molecular formula C19H21ClN2O and a molecular weight of 328.84 g/mol. Its IUPAC name is 2-chloro-4-[(4-hydroxy-3,3-dimethyl-2-phenylbutyl)amino]benzonitrile.
| Compound Name | 2-chloro-4-[(4-hydroxy-3,3-dimethyl-2-phenylbutyl)amino]benzonitrile |
|---|---|
| PubChem CID | 133400367 |
| Molecular Formula | C19H21ClN2O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-chloro-4-[(4-hydroxy-3,3-dimethyl-2-phenylbutyl)amino]benzonitrile |
| SMILES | CC(C)(CO)C(CNc1ccc(C#N)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C19H21ClN2O/c1-19(2,13-23)17(14-6-4-3-5-7-14)12-22-16-9-8-15(11-21)18(20)10-16/h3-10,17,22-23H,12-13H2,1-2H3 |
| InChIKey | WZEXBCMFNWNRCZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |