C17H25ClN4 — CID 99857766
2-chloro-4-[[(2S)-3-(4-ethylpiperazin-1-yl)-2-methylpropyl]amino]benzonitrile (PubChem CID 99857766) has the molecular formula C17H25ClN4 and a molecular weight of 320.87 g/mol. Its IUPAC name is 2-chloro-4-[[(2S)-3-(4-ethylpiperazin-1-yl)-2-methylpropyl]amino]benzonitrile.
| Compound Name | 2-chloro-4-[[(2S)-3-(4-ethylpiperazin-1-yl)-2-methylpropyl]amino]benzonitrile |
|---|---|
| PubChem CID | 99857766 |
| Molecular Formula | C17H25ClN4 |
| Molecular Weight | 320.87 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-chloro-4-[[(2S)-3-(4-ethylpiperazin-1-yl)-2-methylpropyl]amino]benzonitrile |
| SMILES | CCN1CCN(C[C@@H](C)CNc2ccc(C#N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H25ClN4/c1-3-21-6-8-22(9-7-21)13-14(2)12-20-16-5-4-15(11-19)17(18)10-16/h4-5,10,14,20H,3,6-9,12-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | UJZSUORAXIORIA-AWEZNQCLSA-N |
| XLogP | 2.90 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.87 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |