C12H16BrNO3S — CID 106307599
3-bromo-4-[2-(3-hydroxypropylsulfanyl)ethylamino]benzoic acid (PubChem CID 106307599) has the molecular formula C12H16BrNO3S and a molecular weight of 334.24 g/mol. Its IUPAC name is 3-bromo-4-[2-(3-hydroxypropylsulfanyl)ethylamino]benzoic acid.
| Compound Name | 3-bromo-4-[2-(3-hydroxypropylsulfanyl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 106307599 |
| Molecular Formula | C12H16BrNO3S |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 3-bromo-4-[2-(3-hydroxypropylsulfanyl)ethylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCCSCCCO)c(Br)c1 |
| InChI | InChI=1S/C12H16BrNO3S/c13-10-8-9(12(16)17)2-3-11(10)14-4-7-18-6-1-5-15/h2-3,8,14-15H,1,4-7H2,(H,16,17) |
| InChIKey | NYQFNCIBEHMIOI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|