C16H22N4 — CID 112876247
2-methyl-6-N-pentyl-4-N-phenylpyrimidine-4,6-diamine (PubChem CID 112876247) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-methyl-6-N-pentyl-4-N-phenylpyrimidine-4,6-diamine.
| Compound Name | 2-methyl-6-N-pentyl-4-N-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112876247 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-methyl-6-N-pentyl-4-N-phenylpyrimidine-4,6-diamine |
| SMILES | CCCCCNc1cc(Nc2ccccc2)nc(C)n1 |
| InChI | InChI=1S/C16H22N4/c1-3-4-8-11-17-15-12-16(19-13(2)18-15)20-14-9-6-5-7-10-14/h5-7,9-10,12H,3-4,8,11H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | XBLRMAYADUPOQF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|