C20H21ClN4 — CID 112875777
4-N-(3-chlorophenyl)-2-methyl-6-N-(3-phenylpropyl)pyrimidine-4,6-diamine (PubChem CID 112875777) has the molecular formula C20H21ClN4 and a molecular weight of 352.87 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-2-methyl-6-N-(3-phenylpropyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-chlorophenyl)-2-methyl-6-N-(3-phenylpropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112875777 |
| Molecular Formula | C20H21ClN4 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-N-(3-chlorophenyl)-2-methyl-6-N-(3-phenylpropyl)pyrimidine-4,6-diamine |
| SMILES | Cc1nc(NCCCc2ccccc2)cc(Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C20H21ClN4/c1-15-23-19(22-12-6-9-16-7-3-2-4-8-16)14-20(24-15)25-18-11-5-10-17(21)13-18/h2-5,7-8,10-11,13-14H,6,9,12H2,1H3,(H2,22,23,24,25) |
| InChIKey | LSOZDHHHBKOQKC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|