C15H16N4O3 — CID 71689112
methyl 2-(4-acetamidoanilino)-6-methylpyrimidine-4-carboxylate (PubChem CID 71689112) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is methyl 2-(4-acetamidoanilino)-6-methylpyrimidine-4-carboxylate.
| Compound Name | methyl 2-(4-acetamidoanilino)-6-methylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 71689112 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | methyl 2-(4-acetamidoanilino)-6-methylpyrimidine-4-carboxylate |
| SMILES | COC(=O)c1cc(C)nc(Nc2ccc(NC(C)=O)cc2)n1 |
| InChI | InChI=1S/C15H16N4O3/c1-9-8-13(14(21)22-3)19-15(16-9)18-12-6-4-11(5-7-12)17-10(2)20/h4-8H,1-3H3,(H,17,20)(H,16,18,19) |
| InChIKey | XRNFPDFNJHULFM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |