C33H35NO5 — CID 68544588
benzyl 4-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethoxy]-3,5-dimethylphenyl]benzoate (PubChem CID 68544588) has the molecular formula C33H35NO5 and a molecular weight of 525.65 g/mol. Its IUPAC name is benzyl 4-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethoxy]-3,5-dimethylphenyl]benzoate.
| Compound Name | benzyl 4-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethoxy]-3,5-dimethylphenyl]benzoate |
|---|---|
| PubChem CID | 68544588 |
| Molecular Formula | C33H35NO5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | benzyl 4-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethoxy]-3,5-dimethylphenyl]benzoate |
| SMILES | Cc1cc(-c2ccc(C(=O)OCc3ccccc3)cc2)cc(C)c1OCCN[C@@H](C)[C@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C33H35NO5/c1-22-19-29(26-9-11-28(12-10-26)33(37)39-21-25-7-5-4-6-8-25)20-23(2)32(22)38-18-17-34-24(3)31(36)27-13-15-30(35)16-14-27/h4-16,19-20,24,31,34-36H,17-18,21H2,1-3H3/t24-,31-/m0/s1 |
| InChIKey | OQYXZHPDQDRXPO-DLLPINGYSA-N |
| XLogP | 6.12 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|