C28H34N2O8S — CID 69200870
2-[4-[4-[2-[[(1S,2S)-1-hydroxy-1-[4-hydroxy-3-(methanesulfonamido)phenyl]propan-2-yl]amino]ethoxy]-3,5-dimethylphenyl]phenoxy]acetic acid (PubChem CID 69200870) has the molecular formula C28H34N2O8S and a molecular weight of 558.65 g/mol. Its IUPAC name is 2-[4-[4-[2-[[(1S,2S)-1-hydroxy-1-[4-hydroxy-3-(methanesulfonamido)phenyl]propan-2-yl]amino]ethoxy]-3,5-dimethylphenyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[4-[2-[[(1S,2S)-1-hydroxy-1-[4-hydroxy-3-(methanesulfonamido)phenyl]propan-2-yl]amino]ethoxy]-3,5-dimethylphenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 69200870 |
| Molecular Formula | C28H34N2O8S |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 2-[4-[4-[2-[[(1S,2S)-1-hydroxy-1-[4-hydroxy-3-(methanesulfonamido)phenyl]propan-2-yl]amino]ethoxy]-3,5-dimethylphenyl]phenoxy]acetic acid |
| SMILES | Cc1cc(-c2ccc(OCC(=O)O)cc2)cc(C)c1OCCN[C@@H](C)[C@@H](O)c1ccc(O)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C28H34N2O8S/c1-17-13-22(20-5-8-23(9-6-20)38-16-26(32)33)14-18(2)28(17)37-12-11-29-19(3)27(34)21-7-10-25(31)24(15-21)30-39(4,35)36/h5-10,13-15,19,27,29-31,34H,11-12,16H2,1-4H3,(H,32,33)/t19-,27+/m0/s1 |
| InChIKey | XCXQSDFUYFMWMW-UZTOHYMASA-N |
| XLogP | 3.60 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|