C19H24BrNO3 — CID 23090805
4-[2-[2-(4-bromo-2,6-dimethylphenoxy)ethylamino]-1-hydroxypropyl]phenol (PubChem CID 23090805) has the molecular formula C19H24BrNO3 and a molecular weight of 394.31 g/mol. Its IUPAC name is 4-[2-[2-(4-bromo-2,6-dimethylphenoxy)ethylamino]-1-hydroxypropyl]phenol.
| Compound Name | 4-[2-[2-(4-bromo-2,6-dimethylphenoxy)ethylamino]-1-hydroxypropyl]phenol |
|---|---|
| PubChem CID | 23090805 |
| Molecular Formula | C19H24BrNO3 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 4-[2-[2-(4-bromo-2,6-dimethylphenoxy)ethylamino]-1-hydroxypropyl]phenol |
| SMILES | Cc1cc(Br)cc(C)c1OCCNC(C)C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H24BrNO3/c1-12-10-16(20)11-13(2)19(12)24-9-8-21-14(3)18(23)15-4-6-17(22)7-5-15/h4-7,10-11,14,18,21-23H,8-9H2,1-3H3 |
| InChIKey | AGJQFOWZUVDDMB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|