C24H32FNO5 — CID 90729590
4-[2-[2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenoxy]ethylamino]-1-hydroxypropyl]phenol (PubChem CID 90729590) has the molecular formula C24H32FNO5 and a molecular weight of 433.52 g/mol. Its IUPAC name is 4-[2-[2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenoxy]ethylamino]-1-hydroxypropyl]phenol.
| Compound Name | 4-[2-[2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenoxy]ethylamino]-1-hydroxypropyl]phenol |
|---|---|
| PubChem CID | 90729590 |
| Molecular Formula | C24H32FNO5 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 4-[2-[2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenoxy]ethylamino]-1-hydroxypropyl]phenol |
| SMILES | CC(NCCOc1ccc(C2OC(C)(C)C(C)(C)O2)cc1F)C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H32FNO5/c1-15(21(28)16-6-9-18(27)10-7-16)26-12-13-29-20-11-8-17(14-19(20)25)22-30-23(2,3)24(4,5)31-22/h6-11,14-15,21-22,26-28H,12-13H2,1-5H3 |
| InChIKey | ZQNUZCFHHYZVHT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|