C26H31NO3 — CID 141094592
4-[(1S,2R)-1-hydroxy-2-[2-[4-(3-propylphenyl)phenoxy]ethylamino]propyl]phenol (PubChem CID 141094592) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is 4-[(1S,2R)-1-hydroxy-2-[2-[4-(3-propylphenyl)phenoxy]ethylamino]propyl]phenol.
| Compound Name | 4-[(1S,2R)-1-hydroxy-2-[2-[4-(3-propylphenyl)phenoxy]ethylamino]propyl]phenol |
|---|---|
| PubChem CID | 141094592 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 4-[(1S,2R)-1-hydroxy-2-[2-[4-(3-propylphenyl)phenoxy]ethylamino]propyl]phenol |
| SMILES | CCCc1cccc(-c2ccc(OCCN[C@H](C)[C@@H](O)c3ccc(O)cc3)cc2)c1 |
| InChI | InChI=1S/C26H31NO3/c1-3-5-20-6-4-7-23(18-20)21-10-14-25(15-11-21)30-17-16-27-19(2)26(29)22-8-12-24(28)13-9-22/h4,6-15,18-19,26-29H,3,5,16-17H2,1-2H3/t19-,26-/m1/s1 |
| InChIKey | UWHSWXHTSRQBBT-NIYFSFCBSA-N |
| XLogP | 5.10 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|