C25H27NO5 — CID 10320009
4-[4-[2-[[(1S,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethoxy]phenyl]-3-methylbenzoic acid (PubChem CID 10320009) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is 4-[4-[2-[[(1S,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethoxy]phenyl]-3-methylbenzoic acid.
| Compound Name | 4-[4-[2-[[(1S,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethoxy]phenyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 10320009 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 4-[4-[2-[[(1S,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethoxy]phenyl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-c1ccc(OCCN[C@H](C)[C@@H](O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C25H27NO5/c1-16-15-20(25(29)30)7-12-23(16)18-5-10-22(11-6-18)31-14-13-26-17(2)24(28)19-3-8-21(27)9-4-19/h3-12,15,17,24,26-28H,13-14H2,1-2H3,(H,29,30)/t17-,24-/m1/s1 |
| InChIKey | SNZDHIGYIRMKCZ-MZNJEOGPSA-N |
| XLogP | 4.16 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|