C26H30FNO3 — CID 141166481
4-[(1S,2R)-2-[2-[2-fluoro-4-(2-propylphenyl)phenoxy]ethylamino]-1-hydroxypropyl]phenol (PubChem CID 141166481) has the molecular formula C26H30FNO3 and a molecular weight of 423.53 g/mol. Its IUPAC name is 4-[(1S,2R)-2-[2-[2-fluoro-4-(2-propylphenyl)phenoxy]ethylamino]-1-hydroxypropyl]phenol.
| Compound Name | 4-[(1S,2R)-2-[2-[2-fluoro-4-(2-propylphenyl)phenoxy]ethylamino]-1-hydroxypropyl]phenol |
|---|---|
| PubChem CID | 141166481 |
| Molecular Formula | C26H30FNO3 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 4-[(1S,2R)-2-[2-[2-fluoro-4-(2-propylphenyl)phenoxy]ethylamino]-1-hydroxypropyl]phenol |
| SMILES | CCCc1ccccc1-c1ccc(OCCN[C@H](C)[C@@H](O)c2ccc(O)cc2)c(F)c1 |
| InChI | InChI=1S/C26H30FNO3/c1-3-6-19-7-4-5-8-23(19)21-11-14-25(24(27)17-21)31-16-15-28-18(2)26(30)20-9-12-22(29)13-10-20/h4-5,7-14,17-18,26,28-30H,3,6,15-16H2,1-2H3/t18-,26-/m1/s1 |
| InChIKey | OFGUOERZUAWGQY-WXTAPIANSA-N |
| XLogP | 5.24 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|