C20H28N2O7S — CID 44628483
N-[2-hydroxy-5-[(1R,2S)-1-hydroxy-2-[(3,4,5-trimethoxyphenyl)methylamino]propyl]phenyl]methanesulfonamide (PubChem CID 44628483) has the molecular formula C20H28N2O7S and a molecular weight of 440.52 g/mol. Its IUPAC name is N-[2-hydroxy-5-[(1R,2S)-1-hydroxy-2-[(3,4,5-trimethoxyphenyl)methylamino]propyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-hydroxy-5-[(1R,2S)-1-hydroxy-2-[(3,4,5-trimethoxyphenyl)methylamino]propyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 44628483 |
| Molecular Formula | C20H28N2O7S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-[2-hydroxy-5-[(1R,2S)-1-hydroxy-2-[(3,4,5-trimethoxyphenyl)methylamino]propyl]phenyl]methanesulfonamide |
| SMILES | COc1cc(CN[C@@H](C)[C@H](O)c2ccc(O)c(NS(C)(=O)=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H28N2O7S/c1-12(19(24)14-6-7-16(23)15(10-14)22-30(5,25)26)21-11-13-8-17(27-2)20(29-4)18(9-13)28-3/h6-10,12,19,21-24H,11H2,1-5H3/t12-,19-/m0/s1 |
| InChIKey | DUGJBNPMXCUIRB-BUXKBTBVSA-N |
| XLogP | 2.00 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|