C23H23NO3 — CID 101113286
benzyl 4-[(1S,2R)-2-amino-1-hydroxy-3-phenylpropyl]benzoate (PubChem CID 101113286) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is benzyl 4-[(1S,2R)-2-amino-1-hydroxy-3-phenylpropyl]benzoate.
| Compound Name | benzyl 4-[(1S,2R)-2-amino-1-hydroxy-3-phenylpropyl]benzoate |
|---|---|
| PubChem CID | 101113286 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | benzyl 4-[(1S,2R)-2-amino-1-hydroxy-3-phenylpropyl]benzoate |
| SMILES | N[C@H](Cc1ccccc1)[C@@H](O)c1ccc(C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO3/c24-21(15-17-7-3-1-4-8-17)22(25)19-11-13-20(14-12-19)23(26)27-16-18-9-5-2-6-10-18/h1-14,21-22,25H,15-16,24H2/t21-,22+/m1/s1 |
| InChIKey | TUEYFBQNJILHED-YADHBBJMSA-N |
| XLogP | 3.65 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |