C18H21NO4 — CID 150377041
benzyl (2S)-4-amino-2-benzyl-3,4-dihydroxybutanoate (PubChem CID 150377041) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is benzyl (2S)-4-amino-2-benzyl-3,4-dihydroxybutanoate.
| Compound Name | benzyl (2S)-4-amino-2-benzyl-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 150377041 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | benzyl (2S)-4-amino-2-benzyl-3,4-dihydroxybutanoate |
| SMILES | NC(O)C(O)[C@H](Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H21NO4/c19-17(21)16(20)15(11-13-7-3-1-4-8-13)18(22)23-12-14-9-5-2-6-10-14/h1-10,15-17,20-21H,11-12,19H2/t15-,16?,17?/m0/s1 |
| InChIKey | GYXOEBYQWWQVBZ-GTPINHCMSA-N |
| XLogP | 1.23 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|